C15H13F6IrNO2 — CID 59005789
2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 59005789) has the molecular formula C15H13F6IrNO2 and a molecular weight of 545.48 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 59005789 |
| Molecular Formula | C15H13F6IrNO2 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | FC1(F)[C-]=C(c2ccccn2)C(F)(F)C1(F)F.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C10H4F6N.C5H8O2.Ir/c11-8(12)5-6(7-3-1-2-4-17-7)9(13,14)10(8,15)16;1-4(6)3-5(2)7;/h1-4H;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | RVPKDBZCBUDZIM-LWFKIUJUSA-O |
| XLogP | 4.20 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|