C22H26FNO6 — CID 59006400
tert-butyl (3E)-5-(2-ethoxy-2-oxoacetyl)-3-[(4-fluorophenyl)methylidene]-4-oxoazepane-1-carboxylate (PubChem CID 59006400) has the molecular formula C22H26FNO6 and a molecular weight of 419.45 g/mol. Its IUPAC name is tert-butyl (3E)-5-(2-ethoxy-2-oxoacetyl)-3-[(4-fluorophenyl)methylidene]-4-oxoazepane-1-carboxylate.
| Compound Name | tert-butyl (3E)-5-(2-ethoxy-2-oxoacetyl)-3-[(4-fluorophenyl)methylidene]-4-oxoazepane-1-carboxylate |
|---|---|
| PubChem CID | 59006400 |
| Molecular Formula | C22H26FNO6 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | tert-butyl (3E)-5-(2-ethoxy-2-oxoacetyl)-3-[(4-fluorophenyl)methylidene]-4-oxoazepane-1-carboxylate |
| SMILES | CCOC(=O)C(=O)C1CCN(C(=O)OC(C)(C)C)C/C(=C\c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C22H26FNO6/c1-5-29-20(27)19(26)17-10-11-24(21(28)30-22(2,3)4)13-15(18(17)25)12-14-6-8-16(23)9-7-14/h6-9,12,17H,5,10-11,13H2,1-4H3/b15-12+ |
| InChIKey | NXZOMHPNAVMJNP-NTCAYCPXSA-N |
| XLogP | 3.17 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|