C25H17F3N2O2 — CID 59008091
1-[2-[2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone (PubChem CID 59008091) has the molecular formula C25H17F3N2O2 and a molecular weight of 434.42 g/mol. Its IUPAC name is 1-[2-[2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone.
| Compound Name | 1-[2-[2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 59008091 |
| Molecular Formula | C25H17F3N2O2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-[2-[2-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-c1ccc2nc(C#Cc3ccc(OCC(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H17F3N2O2/c1-16(31)20-4-2-3-5-21(20)18-9-12-22-23(14-18)30-24(29-22)13-8-17-6-10-19(11-7-17)32-15-25(26,27)28/h2-7,9-12,14H,15H2,1H3,(H,29,30) |
| InChIKey | IEDHQEUSMCDUBF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|