C21H26O12 — CID 59010764
1-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]hexane-1,2,3,4,5,6-hexol (PubChem CID 59010764) has the molecular formula C21H26O12 and a molecular weight of 470.43 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]hexane-1,2,3,4,5,6-hexol.
| Compound Name | 1-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 59010764 |
| Molecular Formula | C21H26O12 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]hexane-1,2,3,4,5,6-hexol |
| SMILES | OCC(O)C(O)C(O)C(O)C(O)c1c(O)cc2c(c1O)CC(O)C(c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C21H26O12/c22-6-13(27)17(29)19(31)20(32)18(30)15-11(25)5-14-8(16(15)28)4-12(26)21(33-14)7-1-2-9(23)10(24)3-7/h1-3,5,12-13,17-32H,4,6H2 |
| InChIKey | ZTHBKKDFHSBPJP-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 231.76 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|