C7H13NY-2 — CID 59011674
carbanide;4-methanidyl-1,2,3,6-tetrahydropyridine;yttrium (PubChem CID 59011674) has the molecular formula C7H13NY-2 and a molecular weight of 200.09 g/mol. Its IUPAC name is carbanide;4-methanidyl-1,2,3,6-tetrahydropyridine;yttrium.
| Compound Name | carbanide;4-methanidyl-1,2,3,6-tetrahydropyridine;yttrium |
|---|---|
| PubChem CID | 59011674 |
| Molecular Formula | C7H13NY-2 |
| Molecular Weight | 200.09 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | carbanide;4-methanidyl-1,2,3,6-tetrahydropyridine;yttrium |
| SMILES | [CH2-]C1=CCNCC1.[CH3-].[Y] |
| InChI | InChI=1S/C6H10N.CH3.Y/c1-6-2-4-7-5-3-6;;/h2,7H,1,3-5H2;1H3;/q2*-1; |
| InChIKey | XRMRRUUQGGJXKZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.09 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|