C16H17F2N3O — CID 59012232
1-(2-fluoroethyl)-3-[2-(2-fluorophenyl)-1-pyridin-4-ylethyl]urea (PubChem CID 59012232) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-[2-(2-fluorophenyl)-1-pyridin-4-ylethyl]urea.
| Compound Name | 1-(2-fluoroethyl)-3-[2-(2-fluorophenyl)-1-pyridin-4-ylethyl]urea |
|---|---|
| PubChem CID | 59012232 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-(2-fluoroethyl)-3-[2-(2-fluorophenyl)-1-pyridin-4-ylethyl]urea |
| SMILES | O=C(NCCF)NC(Cc1ccccc1F)c1ccncc1 |
| InChI | InChI=1S/C16H17F2N3O/c17-7-10-20-16(22)21-15(12-5-8-19-9-6-12)11-13-3-1-2-4-14(13)18/h1-6,8-9,15H,7,10-11H2,(H2,20,21,22) |
| InChIKey | FFSQWKONUWBJNX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |