C34H35F3N2O6 — CID 59012240
[(E)-1-[6-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]-2-(trifluoromethyl)benzoyl]-9-ethylcarbazol-3-yl]ethylideneamino] propanoate (PubChem CID 59012240) has the molecular formula C34H35F3N2O6 and a molecular weight of 624.66 g/mol. Its IUPAC name is [(E)-1-[6-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]-2-(trifluoromethyl)benzoyl]-9-ethylcarbazol-3-yl]ethylideneamino] propanoate.
| Compound Name | [(E)-1-[6-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]-2-(trifluoromethyl)benzoyl]-9-ethylcarbazol-3-yl]ethylideneamino] propanoate |
|---|---|
| PubChem CID | 59012240 |
| Molecular Formula | C34H35F3N2O6 |
| Molecular Weight | 624.66 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | [(E)-1-[6-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]-2-(trifluoromethyl)benzoyl]-9-ethylcarbazol-3-yl]ethylideneamino] propanoate |
| SMILES | CCC(=O)O/N=C(\C)c1ccc2c(c1)c1cc(C(=O)c3ccc(OCCC4COC(C)(C)O4)cc3C(F)(F)F)ccc1n2CC |
| InChI | InChI=1S/C34H35F3N2O6/c1-6-31(40)45-38-20(3)21-8-12-29-26(16-21)27-17-22(9-13-30(27)39(29)7-2)32(41)25-11-10-23(18-28(25)34(35,36)37)42-15-14-24-19-43-33(4,5)44-24/h8-13,16-18,24H,6-7,14-15,19H2,1-5H3/b38-20+ |
| InChIKey | AGONQJADGCBLOR-CHSHITCJSA-N |
| XLogP | 7.66 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.66 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|