C24H19F2NO4 — CID 69347165
1-[[3-(difluoromethoxy)phenyl]methyl]-3-methyl-2-phenoxyindole-5-carboxylic acid (PubChem CID 69347165) has the molecular formula C24H19F2NO4 and a molecular weight of 423.42 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-3-methyl-2-phenoxyindole-5-carboxylic acid.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-3-methyl-2-phenoxyindole-5-carboxylic acid |
|---|---|
| PubChem CID | 69347165 |
| Molecular Formula | C24H19F2NO4 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-3-methyl-2-phenoxyindole-5-carboxylic acid |
| SMILES | Cc1c(Oc2ccccc2)n(Cc2cccc(OC(F)F)c2)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C24H19F2NO4/c1-15-20-13-17(23(28)29)10-11-21(20)27(22(15)30-18-7-3-2-4-8-18)14-16-6-5-9-19(12-16)31-24(25)26/h2-13,24H,14H2,1H3,(H,28,29) |
| InChIKey | COKHCMGFBGSZLJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |