C27H31NO5 — CID 89273769
prop-2-enyl 1-[[3-[(2R)-1-methoxy-3-methyl-1-oxobutan-2-yl]oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate (PubChem CID 89273769) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is prop-2-enyl 1-[[3-[(2R)-1-methoxy-3-methyl-1-oxobutan-2-yl]oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate.
| Compound Name | prop-2-enyl 1-[[3-[(2R)-1-methoxy-3-methyl-1-oxobutan-2-yl]oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate |
|---|---|
| PubChem CID | 89273769 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | prop-2-enyl 1-[[3-[(2R)-1-methoxy-3-methyl-1-oxobutan-2-yl]oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1)c(C)c(C)n2Cc1cccc(O[C@@H](C(=O)OC)C(C)C)c1 |
| InChI | InChI=1S/C27H31NO5/c1-7-13-32-26(29)21-11-12-24-23(15-21)18(4)19(5)28(24)16-20-9-8-10-22(14-20)33-25(17(2)3)27(30)31-6/h7-12,14-15,17,25H,1,13,16H2,2-6H3/t25-/m1/s1 |
| InChIKey | ZBZZYDCIFGFWKE-RUZDIDTESA-N |
| XLogP | 5.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|