C25H26ClNO5 — CID 89273725
prop-2-enyl 1-[[2-chloro-3-[(2S)-1-methoxy-1-oxopropan-2-yl]oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate (PubChem CID 89273725) has the molecular formula C25H26ClNO5 and a molecular weight of 455.94 g/mol. Its IUPAC name is prop-2-enyl 1-[[2-chloro-3-[(2S)-1-methoxy-1-oxopropan-2-yl]oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate.
| Compound Name | prop-2-enyl 1-[[2-chloro-3-[(2S)-1-methoxy-1-oxopropan-2-yl]oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate |
|---|---|
| PubChem CID | 89273725 |
| Molecular Formula | C25H26ClNO5 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | prop-2-enyl 1-[[2-chloro-3-[(2S)-1-methoxy-1-oxopropan-2-yl]oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1)c(C)c(C)n2Cc1cccc(O[C@@H](C)C(=O)OC)c1Cl |
| InChI | InChI=1S/C25H26ClNO5/c1-6-12-31-25(29)18-10-11-21-20(13-18)15(2)16(3)27(21)14-19-8-7-9-22(23(19)26)32-17(4)24(28)30-5/h6-11,13,17H,1,12,14H2,2-5H3/t17-/m0/s1 |
| InChIKey | FOSGCPZBFCUPPS-KRWDZBQOSA-N |
| XLogP | 5.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|