C25H27NO5 — CID 123349417
prop-2-enyl 1-[[4-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate (PubChem CID 123349417) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is prop-2-enyl 1-[[4-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate.
| Compound Name | prop-2-enyl 1-[[4-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate |
|---|---|
| PubChem CID | 123349417 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | prop-2-enyl 1-[[4-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]methyl]-2,3-dimethylindole-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1)c(C)c(C)n2Cc1ccc(OC(C)C(=O)OC)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-6-13-30-25(28)20-9-12-23-22(14-20)16(2)17(3)26(23)15-19-7-10-21(11-8-19)31-18(4)24(27)29-5/h6-12,14,18H,1,13,15H2,2-5H3 |
| InChIKey | VZTHBQCNEHCIAZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|