C41H35N — CID 59012950
N,N-bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]-2,3-dihydro-1H-inden-4-amine (PubChem CID 59012950) has the molecular formula C41H35N and a molecular weight of 541.74 g/mol. Its IUPAC name is N,N-bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]-2,3-dihydro-1H-inden-4-amine.
| Compound Name | N,N-bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 59012950 |
| Molecular Formula | C41H35N |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | N,N-bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]-2,3-dihydro-1H-inden-4-amine |
| SMILES | C(/C=C/c1ccc(N(c2ccc(/C=C/C=C/c3ccccc3)cc2)c2cccc3c2CCC3)cc1)=C\c1ccccc1 |
| InChI | InChI=1S/C41H35N/c1-3-13-33(14-4-1)17-7-9-19-35-25-29-38(30-26-35)42(41-24-12-22-37-21-11-23-40(37)41)39-31-27-36(28-32-39)20-10-8-18-34-15-5-2-6-16-34/h1-10,12-20,22,24-32H,11,21,23H2/b17-7+,18-8+,19-9+,20-10+ |
| InChIKey | SHLLPFYBUMNBRA-PXOPUTQYSA-N |
| XLogP | 11.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|