C23H20ClF6N7O2 — CID 59013781
4-[3-[(2-aminopyrimidin-4-yl)methoxy]-6-chloro-2-pyridinyl]-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 59013781) has the molecular formula C23H20ClF6N7O2 and a molecular weight of 575.90 g/mol. Its IUPAC name is 4-[3-[(2-aminopyrimidin-4-yl)methoxy]-6-chloro-2-pyridinyl]-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[3-[(2-aminopyrimidin-4-yl)methoxy]-6-chloro-2-pyridinyl]-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 59013781 |
| Molecular Formula | C23H20ClF6N7O2 |
| Molecular Weight | 575.90 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | 4-[3-[(2-aminopyrimidin-4-yl)methoxy]-6-chloro-2-pyridinyl]-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | Nc1nccc(COc2ccc(Cl)nc2N2CCN(C(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)n1 |
| InChI | InChI=1S/C23H20ClF6N7O2/c24-18-2-1-17(39-12-15-3-4-32-20(31)33-15)19(35-18)36-5-7-37(8-6-36)21(38)34-16-10-13(22(25,26)27)9-14(11-16)23(28,29)30/h1-4,9-11H,5-8,12H2,(H,34,38)(H2,31,32,33) |
| InChIKey | FCXPATQIQDGARD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.90 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|