C23H24Cl2FN5O2 — CID 78320926
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-methoxy-6-piperazin-1-yl-2-pyridinyl)pyridin-2-amine (PubChem CID 78320926) has the molecular formula C23H24Cl2FN5O2 and a molecular weight of 492.38 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-methoxy-6-piperazin-1-yl-2-pyridinyl)pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-methoxy-6-piperazin-1-yl-2-pyridinyl)pyridin-2-amine |
|---|---|
| PubChem CID | 78320926 |
| Molecular Formula | C23H24Cl2FN5O2 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-methoxy-6-piperazin-1-yl-2-pyridinyl)pyridin-2-amine |
| SMILES | COc1cc(-c2cnc(N)c(O[C@H](C)c3c(Cl)ccc(F)c3Cl)c2)nc(N2CCNCC2)c1 |
| InChI | InChI=1S/C23H24Cl2FN5O2/c1-13(21-16(24)3-4-17(26)22(21)25)33-19-9-14(12-29-23(19)27)18-10-15(32-2)11-20(30-18)31-7-5-28-6-8-31/h3-4,9-13,28H,5-8H2,1-2H3,(H2,27,29)/t13-/m1/s1 |
| InChIKey | FQLUQGOHDGEPQZ-CYBMUJFWSA-N |
| XLogP | 4.73 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|