C26H22N2S2 — CID 59015060
[1-phenyl-3-(6-pyridin-2-yl-3-pyridinyl)propyl] benzenecarbodithioate (PubChem CID 59015060) has the molecular formula C26H22N2S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is [1-phenyl-3-(6-pyridin-2-yl-3-pyridinyl)propyl] benzenecarbodithioate.
| Compound Name | [1-phenyl-3-(6-pyridin-2-yl-3-pyridinyl)propyl] benzenecarbodithioate |
|---|---|
| PubChem CID | 59015060 |
| Molecular Formula | C26H22N2S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [1-phenyl-3-(6-pyridin-2-yl-3-pyridinyl)propyl] benzenecarbodithioate |
| SMILES | S=C(SC(CCc1ccc(-c2ccccn2)nc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22N2S2/c29-26(22-11-5-2-6-12-22)30-25(21-9-3-1-4-10-21)17-15-20-14-16-24(28-19-20)23-13-7-8-18-27-23/h1-14,16,18-19,25H,15,17H2 |
| InChIKey | NMEXNKQUMZMHSH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|