C33H47N3O5 — CID 59015947
tert-butyl 2-[4-[3-[4-hexyl-1-[(3-methoxyphenyl)methyl]-5-oxo-1,2,4-triazol-3-yl]propyl]phenoxy]-2-methylpropanoate (PubChem CID 59015947) has the molecular formula C33H47N3O5 and a molecular weight of 565.76 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-[4-hexyl-1-[(3-methoxyphenyl)methyl]-5-oxo-1,2,4-triazol-3-yl]propyl]phenoxy]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[4-[3-[4-hexyl-1-[(3-methoxyphenyl)methyl]-5-oxo-1,2,4-triazol-3-yl]propyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 59015947 |
| Molecular Formula | C33H47N3O5 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | tert-butyl 2-[4-[3-[4-hexyl-1-[(3-methoxyphenyl)methyl]-5-oxo-1,2,4-triazol-3-yl]propyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCCCn1c(CCCc2ccc(OC(C)(C)C(=O)OC(C)(C)C)cc2)nn(Cc2cccc(OC)c2)c1=O |
| InChI | InChI=1S/C33H47N3O5/c1-8-9-10-11-22-35-29(34-36(31(35)38)24-26-15-12-16-28(23-26)39-7)17-13-14-25-18-20-27(21-19-25)40-33(5,6)30(37)41-32(2,3)4/h12,15-16,18-21,23H,8-11,13-14,17,22,24H2,1-7H3 |
| InChIKey | AVRMMPXGNVUUFO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 84.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|