C32H30N2O3 — CID 59016327
methyl 1-cyclohexyl-2-[4-(naphthalen-2-ylmethoxy)phenyl]benzimidazole-5-carboxylate (PubChem CID 59016327) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is methyl 1-cyclohexyl-2-[4-(naphthalen-2-ylmethoxy)phenyl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-cyclohexyl-2-[4-(naphthalen-2-ylmethoxy)phenyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 59016327 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | methyl 1-cyclohexyl-2-[4-(naphthalen-2-ylmethoxy)phenyl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1ccc(OCc3ccc4ccccc4c3)cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C32H30N2O3/c1-36-32(35)26-15-18-30-29(20-26)33-31(34(30)27-9-3-2-4-10-27)24-13-16-28(17-14-24)37-21-22-11-12-23-7-5-6-8-25(23)19-22/h5-8,11-20,27H,2-4,9-10,21H2,1H3 |
| InChIKey | TXFWFRZKFCRCLD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |