About (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium
(7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium (PubChem CID 59017734) has the molecular formula C10H8N4Y-2
and a molecular weight of 273.11 g/mol. Its IUPAC name is (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium.
Molecular Properties
| Compound Name | (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium |
| PubChem CID | 59017734 |
| Molecular Formula | C10H8N4Y-2 |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium |
| SMILES | CC1=c2nccnc2=C(C)C(=[N-])C1=[N-].[Y] |
| InChI | InChI=1S/C10H8N4.Y/c1-5-7(11)8(12)6(2)10-9(5)13-3-4-14-10;/h3-4H,1-2H3;/q-2; |
| InChIKey | QDWFHBOPAXBIPR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 70.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium?
The IUPAC name of (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium (CID 59017734) is (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium.
What is the SMILES notation for (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium?
The canonical SMILES for (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium is CC1=c2nccnc2=C(C)C(=[N-])C1=[N-].[Y].
What is the InChIKey of (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium?
The InChIKey is QDWFHBOPAXBIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4.Y/c1-5-7(11)8(12)6(2)10-9(5)13-3-4-14-10;/h3-4H,1-2H3;/q-2;.
What are the key properties of (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium?
(7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium has a molecular weight of 273.11 g/mol, XLogP of -0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-azanidylidene-5,8-dimethylquinoxalin-6-ylidene)azanide;yttrium is sourced from PubChem (CID 59017734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).