C10H10N4 — CID 59017735
5,8-dimethylquinoxaline-6,7-diimine (PubChem CID 59017735) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 5,8-dimethylquinoxaline-6,7-diimine.
| Compound Name | 5,8-dimethylquinoxaline-6,7-diimine |
|---|---|
| PubChem CID | 59017735 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5,8-dimethylquinoxaline-6,7-diimine |
| SMILES | [H]/N=C1/C(C)=c2nccnc2=C(C)/C1=N\[H] |
| InChI | InChI=1S/C10H10N4/c1-5-7(11)8(12)6(2)10-9(5)13-3-4-14-10/h3-4,11-12H,1-2H3/b11-7-,12-8+ |
| InChIKey | YYMRMBFXTGEHJM-NTLHZVPKSA-N |
| XLogP | -0.13 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|