C12H14N4 — CID 59207613
6-N,7-N,5,8-tetramethylquinoxaline-6,7-diimine (PubChem CID 59207613) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 6-N,7-N,5,8-tetramethylquinoxaline-6,7-diimine.
| Compound Name | 6-N,7-N,5,8-tetramethylquinoxaline-6,7-diimine |
|---|---|
| PubChem CID | 59207613 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 6-N,7-N,5,8-tetramethylquinoxaline-6,7-diimine |
| SMILES | C/N=C1/C(C)=c2nccnc2=C(C)/C1=N\C |
| InChI | InChI=1S/C12H14N4/c1-7-9(13-3)10(14-4)8(2)12-11(7)15-5-6-16-12/h5-6H,1-4H3/b13-9-,14-10+ |
| InChIKey | CSEWJFHDBRLENQ-ZKLMZBBOSA-N |
| XLogP | -0.03 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|