C15H18N4 — CID 163660469
6-N,2,3,5-tetramethyl-8-[(E)-prop-1-enyl]quinoxaline-6,7-diimine (PubChem CID 163660469) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 6-N,2,3,5-tetramethyl-8-[(E)-prop-1-enyl]quinoxaline-6,7-diimine.
| Compound Name | 6-N,2,3,5-tetramethyl-8-[(E)-prop-1-enyl]quinoxaline-6,7-diimine |
|---|---|
| PubChem CID | 163660469 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 6-N,2,3,5-tetramethyl-8-[(E)-prop-1-enyl]quinoxaline-6,7-diimine |
| SMILES | [H]/N=C1/C(/C=C/C)=c2nc(C)c(C)nc2=C(C)/C1=N\C |
| InChI | InChI=1S/C15H18N4/c1-6-7-11-12(16)13(17-5)8(2)14-15(11)19-10(4)9(3)18-14/h6-7,16H,1-5H3/b7-6+,16-12-,17-13+ |
| InChIKey | ITYOARRKIKNIRJ-IFLGBTDBSA-N |
| XLogP | 1.10 |
| TPSA | 61.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|