About 4-hydroxy-2,6-dimethylbenzonitrile
4-hydroxy-2,6-dimethylbenzonitrile (PubChem CID 590183) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-hydroxy-2,6-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-hydroxy-2,6-dimethylbenzonitrile |
| PubChem CID | 590183 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 4-hydroxy-2,6-dimethylbenzonitrile |
| SMILES | Cc1cc(O)cc(C)c1C#N |
| InChI | InChI=1S/C9H9NO/c1-6-3-8(11)4-7(2)9(6)5-10/h3-4,11H,1-2H3 |
| InChIKey | KZEJTKHRBQWACL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy-2,6-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,6-dimethylbenzonitrile?
The IUPAC name of 4-hydroxy-2,6-dimethylbenzonitrile (CID 590183) is 4-hydroxy-2,6-dimethylbenzonitrile.
What is the SMILES notation for 4-hydroxy-2,6-dimethylbenzonitrile?
The canonical SMILES for 4-hydroxy-2,6-dimethylbenzonitrile is Cc1cc(O)cc(C)c1C#N.
What is the InChIKey of 4-hydroxy-2,6-dimethylbenzonitrile?
The InChIKey is KZEJTKHRBQWACL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-6-3-8(11)4-7(2)9(6)5-10/h3-4,11H,1-2H3.
What are the key properties of 4-hydroxy-2,6-dimethylbenzonitrile?
4-hydroxy-2,6-dimethylbenzonitrile has a molecular weight of 147.18 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,6-dimethylbenzonitrile is sourced from PubChem (CID 590183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).