C13H14BrN5O3S — CID 59020332
15-bromo-9-oxa-2,13,17,18-tetrazatricyclo[12.3.1.03,8]octadeca-1(17),3(8),4,6,14(18),15-hexaene-5-sulfonamide (PubChem CID 59020332) has the molecular formula C13H14BrN5O3S and a molecular weight of 400.26 g/mol. Its IUPAC name is 15-bromo-9-oxa-2,13,17,18-tetrazatricyclo[12.3.1.03,8]octadeca-1(17),3(8),4,6,14(18),15-hexaene-5-sulfonamide.
| Compound Name | 15-bromo-9-oxa-2,13,17,18-tetrazatricyclo[12.3.1.03,8]octadeca-1(17),3(8),4,6,14(18),15-hexaene-5-sulfonamide |
|---|---|
| PubChem CID | 59020332 |
| Molecular Formula | C13H14BrN5O3S |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 15-bromo-9-oxa-2,13,17,18-tetrazatricyclo[12.3.1.03,8]octadeca-1(17),3(8),4,6,14(18),15-hexaene-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)Nc1ncc(Br)c(n1)NCCCO2 |
| InChI | InChI=1S/C13H14BrN5O3S/c14-9-7-17-13-18-10-6-8(23(15,20)21)2-3-11(10)22-5-1-4-16-12(9)19-13/h2-3,6-7H,1,4-5H2,(H2,15,20,21)(H2,16,17,18,19) |
| InChIKey | FZWPCLGRQDUNDY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |