C16H22INO2 — CID 59021765
tert-butyl N-[[(1R)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]carbamate (PubChem CID 59021765) has the molecular formula C16H22INO2 and a molecular weight of 387.26 g/mol. Its IUPAC name is tert-butyl N-[[(1R)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1R)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 59021765 |
| Molecular Formula | C16H22INO2 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | tert-butyl N-[[(1R)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCCc2cc(I)ccc21 |
| InChI | InChI=1S/C16H22INO2/c1-16(2,3)20-15(19)18-10-12-6-4-5-11-9-13(17)7-8-14(11)12/h7-9,12H,4-6,10H2,1-3H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | BRLWXXOPGXKJMG-LBPRGKRZSA-N |
| XLogP | 4.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|