C13H15IO — CID 159618617
1-[(1S)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]propan-2-one (PubChem CID 159618617) has the molecular formula C13H15IO and a molecular weight of 314.17 g/mol. Its IUPAC name is 1-[(1S)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]propan-2-one.
| Compound Name | 1-[(1S)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]propan-2-one |
|---|---|
| PubChem CID | 159618617 |
| Molecular Formula | C13H15IO |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 1-[(1S)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1CCCc2cc(I)ccc21 |
| InChI | InChI=1S/C13H15IO/c1-9(15)7-10-3-2-4-11-8-12(14)5-6-13(10)11/h5-6,8,10H,2-4,7H2,1H3/t10-/m0/s1 |
| InChIKey | QSSQWRPQQHPJPE-JTQLQIEISA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|