C14H19NO2 — CID 83824130
2-[6-(dimethylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid (PubChem CID 83824130) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[6-(dimethylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid.
| Compound Name | 2-[6-(dimethylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 83824130 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-[6-(dimethylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid |
| SMILES | CN(C)c1ccc2c(c1)CCCC2CC(=O)O |
| InChI | InChI=1S/C14H19NO2/c1-15(2)12-6-7-13-10(8-12)4-3-5-11(13)9-14(16)17/h6-8,11H,3-5,9H2,1-2H3,(H,16,17) |
| InChIKey | YLSPUULJXSZKBU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|