About CID 59022322
CID 59022322 (PubChem CID 59022322) has the molecular formula C24H36N3O5W-
and a molecular weight of 630.41 g/mol.
Molecular Properties
| Compound Name | CID 59022322 |
| PubChem CID | 59022322 |
| Molecular Formula | C24H36N3O5W- |
| Molecular Weight | 630.41 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | — |
| SMILES | CC(=O)[C@@]12CC1/C=C\CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[CH-]C[C@H]1C(=O)N2.[W] |
| InChI | InChI=1S/C24H36N3O5.W/c1-16(28)24-15-17(24)11-8-6-5-7-9-12-18(25-22(31)32-23(2,3)4)21(30)27-14-10-13-19(27)20(29)26-24;/h8,10-11,17-19H,5-7,9,12-15H2,1-4H3,(H,25,31)(H,26,29);/q-1;/b11-8-;/t17?,18-,19-,24-;/m0./s1 |
| InChIKey | ZFASMFVADAEZPY-VSUBBWQESA-N |
| XLogP | 2.67 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 630.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 59022322 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59022322?
The IUPAC name of CID 59022322 (CID 59022322) is not available.
What is the SMILES notation for CID 59022322?
The canonical SMILES for CID 59022322 is CC(=O)[C@@]12CC1/C=C\CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[CH-]C[C@H]1C(=O)N2.[W].
What is the InChIKey of CID 59022322?
The InChIKey is ZFASMFVADAEZPY-VSUBBWQESA-N. The full InChI is InChI=1S/C24H36N3O5.W/c1-16(28)24-15-17(24)11-8-6-5-7-9-12-18(25-22(31)32-23(2,3)4)21(30)27-14-10-13-19(27)20(29)26-24;/h8,10-11,17-19H,5-7,9,12-15H2,1-4H3,(H,25,31)(H,26,29);/q-1;/b11-8-;/t17?,18-,19-,24-;/m0./s1.
What are the key properties of CID 59022322?
CID 59022322 has a molecular weight of 630.41 g/mol, XLogP of 2.67, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59022322 is sourced from PubChem (CID 59022322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).