C24H36N3O5W- — CID 59022322
CID 59022322 (PubChem CID 59022322) has the molecular formula C24H36N3O5W- and a molecular weight of 630.41 g/mol.
| Compound Name | CID 59022322 |
|---|---|
| PubChem CID | 59022322 |
| Molecular Formula | C24H36N3O5W- |
| Molecular Weight | 630.41 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | — |
| SMILES | CC(=O)[C@@]12CC1/C=C\CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[CH-]C[C@H]1C(=O)N2.[W] |
| InChI | InChI=1S/C24H36N3O5.W/c1-16(28)24-15-17(24)11-8-6-5-7-9-12-18(25-22(31)32-23(2,3)4)21(30)27-14-10-13-19(27)20(29)26-24;/h8,10-11,17-19H,5-7,9,12-15H2,1-4H3,(H,25,31)(H,26,29);/q-1;/b11-8-;/t17?,18-,19-,24-;/m0./s1 |
| InChIKey | ZFASMFVADAEZPY-VSUBBWQESA-N |
| XLogP | 2.67 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|