C23H19N3OS2 — CID 59024367
N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-4-thiophen-2-ylbutanamide (PubChem CID 59024367) has the molecular formula C23H19N3OS2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 59024367 |
| Molecular Formula | C23H19N3OS2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C23H19N3OS2/c27-22(9-3-6-18-7-4-10-28-18)25-17-11-16-14-24-26-23(16)19(13-17)21-12-15-5-1-2-8-20(15)29-21/h1-2,4-5,7-8,10-14H,3,6,9H2,(H,24,26)(H,25,27) |
| InChIKey | FSNXRMUSZPJXLO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |