C12H22NO2Ru — CID 59025330
N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide;ruthenium(1+) (PubChem CID 59025330) has the molecular formula C12H22NO2Ru and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide;ruthenium(1+).
| Compound Name | N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide;ruthenium(1+) |
|---|---|
| PubChem CID | 59025330 |
| Molecular Formula | C12H22NO2Ru |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-(2-butan-2-yl-4,5-dimethyloxolan-3-yl)acetamide;ruthenium(1+) |
| SMILES | [CH2-]C(=O)NC1C(C)C(C)OC1C(C)CC.[Ru+] |
| InChI | InChI=1S/C12H22NO2.Ru/c1-6-7(2)12-11(13-10(5)14)8(3)9(4)15-12;/h7-9,11-12H,5-6H2,1-4H3,(H,13,14);/q-1;+1 |
| InChIKey | LBAFAQRQQPDZLZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|