About [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate
[4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate (PubChem CID 59030066) has the molecular formula C19H22ClNO3
and a molecular weight of 347.84 g/mol. Its IUPAC name is [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate.
Molecular Properties
| Compound Name | [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate |
| PubChem CID | 59030066 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate |
| SMILES | CNc1ccc(OC(=O)c2ccc(OCCC(C)C)cc2Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO3/c1-13(2)10-11-23-16-8-9-17(18(20)12-16)19(22)24-15-6-4-14(21-3)5-7-15/h4-9,12-13,21H,10-11H2,1-3H3 |
| InChIKey | CUSGSLORRKVZJJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate?
The IUPAC name of [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate (CID 59030066) is [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate.
What is the SMILES notation for [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate?
The canonical SMILES for [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate is CNc1ccc(OC(=O)c2ccc(OCCC(C)C)cc2Cl)cc1.
What is the InChIKey of [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate?
The InChIKey is CUSGSLORRKVZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClNO3/c1-13(2)10-11-23-16-8-9-17(18(20)12-16)19(22)24-15-6-4-14(21-3)5-7-15/h4-9,12-13,21H,10-11H2,1-3H3.
What are the key properties of [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate?
[4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate has a molecular weight of 347.84 g/mol, XLogP of 5.03, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methylamino)phenyl] 2-chloro-4-(3-methylbutoxy)benzoate is sourced from PubChem (CID 59030066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).