C27H29NO6 — CID 59030055
[4-[4-(methylamino)phenoxy]carbonylphenyl] 2-methoxy-4-(3-methylbutoxy)benzoate (PubChem CID 59030055) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is [4-[4-(methylamino)phenoxy]carbonylphenyl] 2-methoxy-4-(3-methylbutoxy)benzoate.
| Compound Name | [4-[4-(methylamino)phenoxy]carbonylphenyl] 2-methoxy-4-(3-methylbutoxy)benzoate |
|---|---|
| PubChem CID | 59030055 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [4-[4-(methylamino)phenoxy]carbonylphenyl] 2-methoxy-4-(3-methylbutoxy)benzoate |
| SMILES | CNc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(OCCC(C)C)cc3OC)cc2)cc1 |
| InChI | InChI=1S/C27H29NO6/c1-18(2)15-16-32-23-13-14-24(25(17-23)31-4)27(30)34-21-9-5-19(6-10-21)26(29)33-22-11-7-20(28-3)8-12-22/h5-14,17-18,28H,15-16H2,1-4H3 |
| InChIKey | VLUIIUQITSDHBE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|