C35H37NO7 — CID 121446174
[4-[4-(4-methoxybenzoyl)oxyphenyl]phenyl] 2-(3-aminopropoxy)-4-pentoxybenzoate (PubChem CID 121446174) has the molecular formula C35H37NO7 and a molecular weight of 583.68 g/mol. Its IUPAC name is [4-[4-(4-methoxybenzoyl)oxyphenyl]phenyl] 2-(3-aminopropoxy)-4-pentoxybenzoate.
| Compound Name | [4-[4-(4-methoxybenzoyl)oxyphenyl]phenyl] 2-(3-aminopropoxy)-4-pentoxybenzoate |
|---|---|
| PubChem CID | 121446174 |
| Molecular Formula | C35H37NO7 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | [4-[4-(4-methoxybenzoyl)oxyphenyl]phenyl] 2-(3-aminopropoxy)-4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(=O)c4ccc(OC)cc4)cc3)cc2)c(OCCCN)c1 |
| InChI | InChI=1S/C35H37NO7/c1-3-4-5-22-40-31-19-20-32(33(24-31)41-23-6-21-36)35(38)43-30-17-9-26(10-18-30)25-7-15-29(16-8-25)42-34(37)27-11-13-28(39-2)14-12-27/h7-20,24H,3-6,21-23,36H2,1-2H3 |
| InChIKey | KLQVECDNABVOOC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|