C41H51NO7 — CID 121446179
[4-[4-(4-methoxycyclohexa-2,4-diene-1-carbonyl)oxyphenyl]phenyl] 2-(6-aminohexoxy)-4-octoxybenzoate (PubChem CID 121446179) has the molecular formula C41H51NO7 and a molecular weight of 669.86 g/mol. Its IUPAC name is [4-[4-(4-methoxycyclohexa-2,4-diene-1-carbonyl)oxyphenyl]phenyl] 2-(6-aminohexoxy)-4-octoxybenzoate.
| Compound Name | [4-[4-(4-methoxycyclohexa-2,4-diene-1-carbonyl)oxyphenyl]phenyl] 2-(6-aminohexoxy)-4-octoxybenzoate |
|---|---|
| PubChem CID | 121446179 |
| Molecular Formula | C41H51NO7 |
| Molecular Weight | 669.86 g/mol |
| Exact Mass | 669.37 |
| IUPAC Name | [4-[4-(4-methoxycyclohexa-2,4-diene-1-carbonyl)oxyphenyl]phenyl] 2-(6-aminohexoxy)-4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(=O)C4C=CC(OC)=CC4)cc3)cc2)c(OCCCCCCN)c1 |
| InChI | InChI=1S/C41H51NO7/c1-3-4-5-6-8-11-28-46-37-25-26-38(39(30-37)47-29-12-9-7-10-27-42)41(44)49-36-23-15-32(16-24-36)31-13-21-35(22-14-31)48-40(43)33-17-19-34(45-2)20-18-33/h13-17,19-26,30,33H,3-12,18,27-29,42H2,1-2H3 |
| InChIKey | KDGKCCIBBUDVCN-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.86 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|