C20H27NO4S — CID 59030292
[3-(2-ethyl-4,6-dimethylphenyl)-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate (PubChem CID 59030292) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is [3-(2-ethyl-4,6-dimethylphenyl)-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate.
| Compound Name | [3-(2-ethyl-4,6-dimethylphenyl)-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 59030292 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [3-(2-ethyl-4,6-dimethylphenyl)-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate |
| SMILES | CCc1cc(C)cc(C)c1C1=C(OS(C)(=O)=O)C2(CCCCC2)NC1=O |
| InChI | InChI=1S/C20H27NO4S/c1-5-15-12-13(2)11-14(3)16(15)17-18(25-26(4,23)24)20(21-19(17)22)9-7-6-8-10-20/h11-12H,5-10H2,1-4H3,(H,21,22) |
| InChIKey | LXDZUUXYURWCFE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|