C27H29NO4 — CID 59031142
(E)-3-[4-[4-(benzylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-methylprop-2-enoic acid (PubChem CID 59031142) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is (E)-3-[4-[4-(benzylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(benzylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 59031142 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (E)-3-[4-[4-(benzylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1c(C)c(-c2ccc(NCc3ccccc3)cc2)c(OC)c(C)c1/C=C(\C)C(=O)O |
| InChI | InChI=1S/C27H29NO4/c1-17(27(29)30)15-23-18(2)26(32-5)24(19(3)25(23)31-4)21-11-13-22(14-12-21)28-16-20-9-7-6-8-10-20/h6-15,28H,16H2,1-5H3,(H,29,30)/b17-15+ |
| InChIKey | PWSRYVKFAMCBAW-BMRADRMJSA-N |
| XLogP | 6.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|