C33H25NO2P+ — CID 59031839
[3-(5-methyl-1,3-dioxoisoindol-2-yl)phenyl]-triphenylphosphanium (PubChem CID 59031839) has the molecular formula C33H25NO2P+ and a molecular weight of 498.54 g/mol. Its IUPAC name is [3-(5-methyl-1,3-dioxoisoindol-2-yl)phenyl]-triphenylphosphanium.
| Compound Name | [3-(5-methyl-1,3-dioxoisoindol-2-yl)phenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 59031839 |
| Molecular Formula | C33H25NO2P+ |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [3-(5-methyl-1,3-dioxoisoindol-2-yl)phenyl]-triphenylphosphanium |
| SMILES | Cc1ccc2c(c1)C(=O)N(c1cccc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)c1)C2=O |
| InChI | InChI=1S/C33H25NO2P/c1-24-20-21-30-31(22-24)33(36)34(32(30)35)25-12-11-19-29(23-25)37(26-13-5-2-6-14-26,27-15-7-3-8-16-27)28-17-9-4-10-18-28/h2-23H,1H3/q+1 |
| InChIKey | QBGMXHVPWGEQJE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|