C26H22F4O5 — CID 59036588
(3-ethoxy-1,1,1-trifluoropropan-2-yl) 2-fluoro-4-[4-(4-methylphenyl)benzoyl]oxybenzoate (PubChem CID 59036588) has the molecular formula C26H22F4O5 and a molecular weight of 490.45 g/mol. Its IUPAC name is (3-ethoxy-1,1,1-trifluoropropan-2-yl) 2-fluoro-4-[4-(4-methylphenyl)benzoyl]oxybenzoate.
| Compound Name | (3-ethoxy-1,1,1-trifluoropropan-2-yl) 2-fluoro-4-[4-(4-methylphenyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 59036588 |
| Molecular Formula | C26H22F4O5 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | (3-ethoxy-1,1,1-trifluoropropan-2-yl) 2-fluoro-4-[4-(4-methylphenyl)benzoyl]oxybenzoate |
| SMILES | CCOCC(OC(=O)c1ccc(OC(=O)c2ccc(-c3ccc(C)cc3)cc2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C26H22F4O5/c1-3-33-15-23(26(28,29)30)35-25(32)21-13-12-20(14-22(21)27)34-24(31)19-10-8-18(9-11-19)17-6-4-16(2)5-7-17/h4-14,23H,3,15H2,1-2H3 |
| InChIKey | QVFOMFMNEABYEA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|