C38H53NO4 — CID 59037919
(1'E,14'S)-3'-[4-[cyclohexyl(methyl)amino]phenyl]-5'-methyl-6'-prop-1-ynylspiro[1,3-dioxolane-2,16'-tetracyclo[12.4.1.02,10.05,9]nonadec-1-ene]-6',14'-diol (PubChem CID 59037919) has the molecular formula C38H53NO4 and a molecular weight of 587.85 g/mol. Its IUPAC name is (1'E,14'S)-3'-[4-[cyclohexyl(methyl)amino]phenyl]-5'-methyl-6'-prop-1-ynylspiro[1,3-dioxolane-2,16'-tetracyclo[12.4.1.02,10.05,9]nonadec-1-ene]-6',14'-diol.
| Compound Name | (1'E,14'S)-3'-[4-[cyclohexyl(methyl)amino]phenyl]-5'-methyl-6'-prop-1-ynylspiro[1,3-dioxolane-2,16'-tetracyclo[12.4.1.02,10.05,9]nonadec-1-ene]-6',14'-diol |
|---|---|
| PubChem CID | 59037919 |
| Molecular Formula | C38H53NO4 |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 587.40 |
| IUPAC Name | (1'E,14'S)-3'-[4-[cyclohexyl(methyl)amino]phenyl]-5'-methyl-6'-prop-1-ynylspiro[1,3-dioxolane-2,16'-tetracyclo[12.4.1.02,10.05,9]nonadec-1-ene]-6',14'-diol |
| SMILES | CC#CC1(O)CCC2C3CCC[C@]4(O)C/C(=C\3C(c3ccc(N(C)C5CCCCC5)cc3)CC21C)CCC1(C4)OCCO1 |
| InChI | InChI=1S/C38H53NO4/c1-4-18-37(41)20-17-33-31-11-8-19-36(40)24-28(16-21-38(26-36)42-22-23-43-38)34(31)32(25-35(33,37)2)27-12-14-30(15-13-27)39(3)29-9-6-5-7-10-29/h12-15,29,31-33,40-41H,5-11,16-17,19-26H2,1-3H3/b34-28+/t31?,32?,33?,35?,36-,37?/m0/s1 |
| InChIKey | WGQPVUMFUFMXER-PSBWPVQVSA-N |
| XLogP | 7.26 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|