C34H43NO3 — CID 23558764
11-[4-[cyclohexyl(methyl)amino]phenyl]-17-hydroxy-17-(3-hydroxyprop-1-ynyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 23558764) has the molecular formula C34H43NO3 and a molecular weight of 513.72 g/mol. Its IUPAC name is 11-[4-[cyclohexyl(methyl)amino]phenyl]-17-hydroxy-17-(3-hydroxyprop-1-ynyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 11-[4-[cyclohexyl(methyl)amino]phenyl]-17-hydroxy-17-(3-hydroxyprop-1-ynyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 23558764 |
| Molecular Formula | C34H43NO3 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 11-[4-[cyclohexyl(methyl)amino]phenyl]-17-hydroxy-17-(3-hydroxyprop-1-ynyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN(c1ccc(C2CC3(C)C(CCC3(O)C#CCO)C3CCC4=CC(=O)CCC4=C23)cc1)C1CCCCC1 |
| InChI | InChI=1S/C34H43NO3/c1-33-22-30(23-9-12-26(13-10-23)35(2)25-7-4-3-5-8-25)32-28-16-14-27(37)21-24(28)11-15-29(32)31(33)17-19-34(33,38)18-6-20-36/h9-10,12-13,21,25,29-31,36,38H,3-5,7-8,11,14-17,19-20,22H2,1-2H3 |
| InChIKey | NNZJGNJGNMFXOQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|