C9H21N2O2P — CID 59038627
(2S)-2-amino-N-[(3S)-4-phosphanyloxyhexan-3-yl]propanamide (PubChem CID 59038627) has the molecular formula C9H21N2O2P and a molecular weight of 220.25 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3S)-4-phosphanyloxyhexan-3-yl]propanamide.
| Compound Name | (2S)-2-amino-N-[(3S)-4-phosphanyloxyhexan-3-yl]propanamide |
|---|---|
| PubChem CID | 59038627 |
| Molecular Formula | C9H21N2O2P |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2S)-2-amino-N-[(3S)-4-phosphanyloxyhexan-3-yl]propanamide |
| SMILES | CCC(OP)[C@H](CC)NC(=O)[C@H](C)N |
| InChI | InChI=1S/C9H21N2O2P/c1-4-7(8(5-2)13-14)11-9(12)6(3)10/h6-8H,4-5,10,14H2,1-3H3,(H,11,12)/t6-,7-,8?/m0/s1 |
| InChIKey | MLTZYYQNANWOHF-WPZUCAASSA-N |
| XLogP | 0.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|