C27H29ClN4O2 — CID 59038999
tert-butyl (2S)-2-[2-(4-chloro-2-phenylimidazo[4,5-c]quinolin-1-yl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 59038999) has the molecular formula C27H29ClN4O2 and a molecular weight of 477.01 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-(4-chloro-2-phenylimidazo[4,5-c]quinolin-1-yl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-(4-chloro-2-phenylimidazo[4,5-c]quinolin-1-yl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59038999 |
| Molecular Formula | C27H29ClN4O2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | tert-butyl (2S)-2-[2-(4-chloro-2-phenylimidazo[4,5-c]quinolin-1-yl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CCn1c(-c2ccccc2)nc2c(Cl)nc3ccccc3c21 |
| InChI | InChI=1S/C27H29ClN4O2/c1-27(2,3)34-26(33)31-16-9-12-19(31)15-17-32-23-20-13-7-8-14-21(20)29-24(28)22(23)30-25(32)18-10-5-4-6-11-18/h4-8,10-11,13-14,19H,9,12,15-17H2,1-3H3/t19-/m0/s1 |
| InChIKey | JTYLZHYVXOAXEO-IBGZPJMESA-N |
| XLogP | 6.69 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|