C12H24O — CID 59039343
(4R)-4-methoxy-5,5-dimethyl-4-propan-2-ylhex-1-ene (PubChem CID 59039343) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (4R)-4-methoxy-5,5-dimethyl-4-propan-2-ylhex-1-ene.
| Compound Name | (4R)-4-methoxy-5,5-dimethyl-4-propan-2-ylhex-1-ene |
|---|---|
| PubChem CID | 59039343 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (4R)-4-methoxy-5,5-dimethyl-4-propan-2-ylhex-1-ene |
| SMILES | C=CC[C@@](OC)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24O/c1-8-9-12(13-7,10(2)3)11(4,5)6/h8,10H,1,9H2,2-7H3/t12-/m1/s1 |
| InChIKey | OSYAUJCXZUDASH-GFCCVEGCSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|