C14H23NO — CID 59039395
(NZ)-N-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-ethylpentylidene]hydroxylamine (PubChem CID 59039395) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (NZ)-N-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-ethylpentylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-ethylpentylidene]hydroxylamine |
|---|---|
| PubChem CID | 59039395 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (NZ)-N-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-ethylpentylidene]hydroxylamine |
| SMILES | CCC(CC)C/C(=N/O)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H23NO/c1-3-10(4-2)9-14(15-16)13-8-11-5-6-12(13)7-11/h5-6,10-13,16H,3-4,7-9H2,1-2H3/b15-14-/t11-,12+,13-/m1/s1 |
| InChIKey | GFUYCUWCQAEEFL-HLOXPZGFSA-N |
| XLogP | 3.86 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|