C26H37N5O3 — CID 59040989
(2S)-N-(4-cyano-1-pentylpiperidin-4-yl)-4,4-dimethyl-2-[(2-oxo-1,3-benzoxazin-4-yl)amino]pentanamide (PubChem CID 59040989) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is (2S)-N-(4-cyano-1-pentylpiperidin-4-yl)-4,4-dimethyl-2-[(2-oxo-1,3-benzoxazin-4-yl)amino]pentanamide.
| Compound Name | (2S)-N-(4-cyano-1-pentylpiperidin-4-yl)-4,4-dimethyl-2-[(2-oxo-1,3-benzoxazin-4-yl)amino]pentanamide |
|---|---|
| PubChem CID | 59040989 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (2S)-N-(4-cyano-1-pentylpiperidin-4-yl)-4,4-dimethyl-2-[(2-oxo-1,3-benzoxazin-4-yl)amino]pentanamide |
| SMILES | CCCCCN1CCC(C#N)(NC(=O)[C@H](CC(C)(C)C)Nc2nc(=O)oc3ccccc23)CC1 |
| InChI | InChI=1S/C26H37N5O3/c1-5-6-9-14-31-15-12-26(18-27,13-16-31)30-23(32)20(17-25(2,3)4)28-22-19-10-7-8-11-21(19)34-24(33)29-22/h7-8,10-11,20H,5-6,9,12-17H2,1-4H3,(H,30,32)(H,28,29,33)/t20-/m0/s1 |
| InChIKey | HAZCBXOAGZNLSM-FQEVSTJZSA-N |
| XLogP | 4.07 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|