C16H20N2O4 — CID 22566359
5,5-dimethyl-2-[(2-oxo-1,3-benzoxazin-4-yl)amino]hexanoic acid (PubChem CID 22566359) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(2-oxo-1,3-benzoxazin-4-yl)amino]hexanoic acid.
| Compound Name | 5,5-dimethyl-2-[(2-oxo-1,3-benzoxazin-4-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 22566359 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5,5-dimethyl-2-[(2-oxo-1,3-benzoxazin-4-yl)amino]hexanoic acid |
| SMILES | CC(C)(C)CCC(Nc1nc(=O)oc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O4/c1-16(2,3)9-8-11(14(19)20)17-13-10-6-4-5-7-12(10)22-15(21)18-13/h4-7,11H,8-9H2,1-3H3,(H,19,20)(H,17,18,21) |
| InChIKey | SKBCMXHEYKBYOC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |