C6H6N4O2 — CID 590411
7-hydroxy-7,8-dihydro-5H-pteridin-6-one (PubChem CID 590411) has the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. Its IUPAC name is 7-hydroxy-7,8-dihydro-5H-pteridin-6-one.
| Compound Name | 7-hydroxy-7,8-dihydro-5H-pteridin-6-one |
|---|---|
| PubChem CID | 590411 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 7-hydroxy-7,8-dihydro-5H-pteridin-6-one |
| SMILES | O=C1Nc2cncnc2NC1O |
| InChI | InChI=1S/C6H6N4O2/c11-5-6(12)10-4-3(9-5)1-7-2-8-4/h1-2,6,12H,(H,9,11)(H,7,8,10) |
| InChIKey | LRFSFYZJLWZZGY-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |