C27H31NO8 — CID 59042426
2-[3-[3-(4-acetyloxyphenyl)-1-[(2S)-1-acetylpiperidine-2-carbonyl]oxypropyl]phenoxy]acetic acid (PubChem CID 59042426) has the molecular formula C27H31NO8 and a molecular weight of 497.54 g/mol. Its IUPAC name is 2-[3-[3-(4-acetyloxyphenyl)-1-[(2S)-1-acetylpiperidine-2-carbonyl]oxypropyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[3-(4-acetyloxyphenyl)-1-[(2S)-1-acetylpiperidine-2-carbonyl]oxypropyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 59042426 |
| Molecular Formula | C27H31NO8 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2-[3-[3-(4-acetyloxyphenyl)-1-[(2S)-1-acetylpiperidine-2-carbonyl]oxypropyl]phenoxy]acetic acid |
| SMILES | CC(=O)Oc1ccc(CCC(OC(=O)[C@@H]2CCCCN2C(C)=O)c2cccc(OCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H31NO8/c1-18(29)28-15-4-3-8-24(28)27(33)36-25(21-6-5-7-23(16-21)34-17-26(31)32)14-11-20-9-12-22(13-10-20)35-19(2)30/h5-7,9-10,12-13,16,24-25H,3-4,8,11,14-15,17H2,1-2H3,(H,31,32)/t24-,25?/m0/s1 |
| InChIKey | RXWNRYMLAHBXRY-SKCDSABHSA-N |
| XLogP | 3.69 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|