About CID 59042822
CID 59042822 (PubChem CID 59042822) has the molecular formula C9H21N2
and a molecular weight of 157.28 g/mol.
Molecular Properties
| Compound Name | CID 59042822 |
| PubChem CID | 59042822 |
| Molecular Formula | C9H21N2 |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.17 |
| IUPAC Name | — |
| SMILES | CCCNC(C)C[CH]CNC |
| InChI | InChI=1S/C9H21N2/c1-4-7-11-9(2)6-5-8-10-3/h5,9-11H,4,6-8H2,1-3H3 |
| InChIKey | IUAYGBQICCHYJG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 59042822 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59042822?
The IUPAC name of CID 59042822 (CID 59042822) is not available.
What is the SMILES notation for CID 59042822?
The canonical SMILES for CID 59042822 is CCCNC(C)C[CH]CNC.
What is the InChIKey of CID 59042822?
The InChIKey is IUAYGBQICCHYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N2/c1-4-7-11-9(2)6-5-8-10-3/h5,9-11H,4,6-8H2,1-3H3.
What are the key properties of CID 59042822?
CID 59042822 has a molecular weight of 157.28 g/mol, XLogP of 1.19, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59042822 is sourced from PubChem (CID 59042822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).