C18H36O4 — CID 59046060
7,7,16,16-tetramethyl-1,4,10,13-tetraoxacyclooctadecane (PubChem CID 59046060) has the molecular formula C18H36O4 and a molecular weight of 316.48 g/mol. Its IUPAC name is 7,7,16,16-tetramethyl-1,4,10,13-tetraoxacyclooctadecane.
| Compound Name | 7,7,16,16-tetramethyl-1,4,10,13-tetraoxacyclooctadecane |
|---|---|
| PubChem CID | 59046060 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 7,7,16,16-tetramethyl-1,4,10,13-tetraoxacyclooctadecane |
| SMILES | CC1(C)CCOCCOCCC(C)(C)CCOCCOCC1 |
| InChI | InChI=1S/C18H36O4/c1-17(2)5-9-19-13-15-21-11-7-18(3,4)8-12-22-16-14-20-10-6-17/h5-16H2,1-4H3 |
| InChIKey | SKTOGKNPYUSWLL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |