C18H34O5 — CID 58704531
4,7,13,16,21-pentaoxabicyclo[8.8.5]tricosane (PubChem CID 58704531) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4,7,13,16,21-pentaoxabicyclo[8.8.5]tricosane.
| Compound Name | 4,7,13,16,21-pentaoxabicyclo[8.8.5]tricosane |
|---|---|
| PubChem CID | 58704531 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 4,7,13,16,21-pentaoxabicyclo[8.8.5]tricosane |
| SMILES | C1COCCC2CCOCCOCCC(CCO1)CCOCC2 |
| InChI | InChI=1S/C18H34O5/c1-7-19-8-2-18-5-11-22-15-13-20-9-3-17(1)4-10-21-14-16-23-12-6-18/h17-18H,1-16H2 |
| InChIKey | QVWQGSCACMEQCX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |